About methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate
methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate (PubChem CID 75024234) has the molecular formula C23H23F6NO3
and a molecular weight of 475.43 g/mol. Its IUPAC name is methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate |
| PubChem CID | 75024234 |
| Molecular Formula | C23H23F6NO3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C1CCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C23H23F6NO3/c1-30(21(31)32-2)18-8-9-19(20(18)15-6-4-3-5-7-15)33-13-14-10-16(22(24,25)26)12-17(11-14)23(27,28)29/h3-7,10-12,18-20H,8-9,13H2,1-2H3 |
| InChIKey | XLQRBGCAMPLWHK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate?
The IUPAC name of methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate (CID 75024234) is methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate?
The canonical SMILES for methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate is COC(=O)N(C)C1CCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1.
What is the InChIKey of methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate?
The InChIKey is XLQRBGCAMPLWHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F6NO3/c1-30(21(31)32-2)18-8-9-19(20(18)15-6-4-3-5-7-15)33-13-14-10-16(22(24,25)26)12-17(11-14)23(27,28)29/h3-7,10-12,18-20H,8-9,13H2,1-2H3.
What are the key properties of methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate?
methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate has a molecular weight of 475.43 g/mol, XLogP of 6.25, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylcyclopentyl]-N-methylcarbamate is sourced from PubChem (CID 75024234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).