About 1-ethylperimidine
1-ethylperimidine (PubChem CID 750289) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-ethylperimidine.
Molecular Properties
| Compound Name | 1-ethylperimidine |
| PubChem CID | 750289 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-ethylperimidine |
| SMILES | CCN1C=Nc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H12N2/c1-2-15-9-14-11-7-3-5-10-6-4-8-12(15)13(10)11/h3-9H,2H2,1H3 |
| InChIKey | CQHQYCYSGAZQKE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylperimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylperimidine?
The IUPAC name of 1-ethylperimidine (CID 750289) is 1-ethylperimidine.
What is the SMILES notation for 1-ethylperimidine?
The canonical SMILES for 1-ethylperimidine is CCN1C=Nc2cccc3cccc1c23.
What is the InChIKey of 1-ethylperimidine?
The InChIKey is CQHQYCYSGAZQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-2-15-9-14-11-7-3-5-10-6-4-8-12(15)13(10)11/h3-9H,2H2,1H3.
What are the key properties of 1-ethylperimidine?
1-ethylperimidine has a molecular weight of 196.25 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylperimidine is sourced from PubChem (CID 750289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).