About 2-methyl-1H-perimidine
2-methyl-1H-perimidine (PubChem CID 750290) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-methyl-1H-perimidine.
Molecular Properties
| Compound Name | 2-methyl-1H-perimidine |
| PubChem CID | 750290 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-methyl-1H-perimidine |
| SMILES | CC1=Nc2cccc3cccc(c23)N1 |
| InChI | InChI=1S/C12H10N2/c1-8-13-10-6-2-4-9-5-3-7-11(14-8)12(9)10/h2-7H,1H3,(H,13,14) |
| InChIKey | HJXMORWPPSSVMF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1H-perimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-perimidine?
The IUPAC name of 2-methyl-1H-perimidine (CID 750290) is 2-methyl-1H-perimidine.
What is the SMILES notation for 2-methyl-1H-perimidine?
The canonical SMILES for 2-methyl-1H-perimidine is CC1=Nc2cccc3cccc(c23)N1.
What is the InChIKey of 2-methyl-1H-perimidine?
The InChIKey is HJXMORWPPSSVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-8-13-10-6-2-4-9-5-3-7-11(14-8)12(9)10/h2-7H,1H3,(H,13,14).
What are the key properties of 2-methyl-1H-perimidine?
2-methyl-1H-perimidine has a molecular weight of 182.23 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-perimidine is sourced from PubChem (CID 750290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).