C20H27N7O5S2 — CID 75029597
2-(benzenesulfonamido)-N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-N-methylacetamide (PubChem CID 75029597) has the molecular formula C20H27N7O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 75029597 |
| Molecular Formula | C20H27N7O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-N-methylacetamide |
| SMILES | CN(CC(=O)NC(CCCN=C(N)N)C(=O)c1nccs1)C(=O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H27N7O5S2/c1-27(17(29)12-25-34(31,32)14-6-3-2-4-7-14)13-16(28)26-15(8-5-9-24-20(21)22)18(30)19-23-10-11-33-19/h2-4,6-7,10-11,15,25H,5,8-9,12-13H2,1H3,(H,26,28)(H4,21,22,24) |
| InChIKey | GJNJUHMPYZAMBU-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 189.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|