C16H16ClNO6S — CID 7503758
2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-hydroxybenzoate (PubChem CID 7503758) has the molecular formula C16H16ClNO6S and a molecular weight of 385.83 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-hydroxybenzoate.
| Compound Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7503758 |
| Molecular Formula | C16H16ClNO6S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 5-chloro-2-hydroxybenzoate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCOC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H16ClNO6S/c1-2-23-15(21)8-14-18(13(20)9-25-14)5-6-24-16(22)11-7-10(17)3-4-12(11)19/h3-4,7-8,19H,2,5-6,9H2,1H3/b14-8- |
| InChIKey | WKPFBVKTURFVNF-ZSOIEALJSA-N |
| XLogP | 2.18 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|