About [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane
[2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane (PubChem CID 75037996) has the molecular formula C25H34NOP
and a molecular weight of 395.53 g/mol. Its IUPAC name is [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane.
Molecular Properties
| Compound Name | [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane |
| PubChem CID | 75037996 |
| Molecular Formula | C25H34NOP |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(CC(C)(C)C1=NC(C(C)(C)C)CO1)c1ccccc1C |
| InChI | InChI=1S/C25H34NOP/c1-18-12-8-10-14-20(18)28(21-15-11-9-13-19(21)2)17-25(6,7)23-26-22(16-27-23)24(3,4)5/h8-15,22H,16-17H2,1-7H3 |
| InChIKey | TZGODYQOHHPDPC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane?
The IUPAC name of [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane (CID 75037996) is [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane.
What is the SMILES notation for [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane?
The canonical SMILES for [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane is Cc1ccccc1P(CC(C)(C)C1=NC(C(C)(C)C)CO1)c1ccccc1C.
What is the InChIKey of [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane?
The InChIKey is TZGODYQOHHPDPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34NOP/c1-18-12-8-10-14-20(18)28(21-15-11-9-13-19(21)2)17-25(6,7)23-26-22(16-27-23)24(3,4)5/h8-15,22H,16-17H2,1-7H3.
What are the key properties of [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane?
[2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane has a molecular weight of 395.53 g/mol, XLogP of 5.61, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(2-methylphenyl)phosphane is sourced from PubChem (CID 75037996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).