C19H24FNO6 — CID 75038754
4-fluoro-N-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl]benzamide (PubChem CID 75038754) has the molecular formula C19H24FNO6 and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-fluoro-N-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl]benzamide |
|---|---|
| PubChem CID | 75038754 |
| Molecular Formula | C19H24FNO6 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-fluoro-N-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl]benzamide |
| SMILES | CC1(C)OC2OC(CNC(=O)c3ccc(F)cc3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C19H24FNO6/c1-18(2)24-13-12(9-21-16(22)10-5-7-11(20)8-6-10)23-17-15(14(13)25-18)26-19(3,4)27-17/h5-8,12-15,17H,9H2,1-4H3,(H,21,22) |
| InChIKey | DFQZCHBEZAJEDM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |