C36H60O8 — CID 75039153
2-[[9,10,14-trihydroxy-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol (PubChem CID 75039153) has the molecular formula C36H60O8 and a molecular weight of 620.87 g/mol. Its IUPAC name is 2-[[9,10,14-trihydroxy-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-[[9,10,14-trihydroxy-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 75039153 |
| Molecular Formula | C36H60O8 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | 2-[[9,10,14-trihydroxy-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
| SMILES | C=C(CCC(C)C1C(O)CC2(C)C3C(O)C(O)C4C(C)(C)C(OC5OCC(O)C(O)C5O)CCC45CC35CCC12C)C(C)C |
| InChI | InChI=1S/C36H60O8/c1-18(2)19(3)9-10-20(4)24-21(37)15-34(8)30-27(41)26(40)29-32(5,6)23(44-31-28(42)25(39)22(38)16-43-31)11-12-35(29)17-36(30,35)14-13-33(24,34)7/h18,20-31,37-42H,3,9-17H2,1-2,4-8H3 |
| InChIKey | DVCPMPFCMZEZDA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|