C17H21NO — CID 750408
(E)-1-(2,2,4,6-tetramethylquinolin-1-yl)but-2-en-1-one (PubChem CID 750408) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (E)-1-(2,2,4,6-tetramethylquinolin-1-yl)but-2-en-1-one.
| Compound Name | (E)-1-(2,2,4,6-tetramethylquinolin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 750408 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (E)-1-(2,2,4,6-tetramethylquinolin-1-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1c2ccc(C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C17H21NO/c1-6-7-16(19)18-15-9-8-12(2)10-14(15)13(3)11-17(18,4)5/h6-11H,1-5H3/b7-6+ |
| InChIKey | BNIYOKRWDLGTJC-VOTSOKGWSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|