C7H11NO2 — CID 75041717
5-ethenyl-3,4-dimethyl-1,3-oxazolidin-2-one (PubChem CID 75041717) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 5-ethenyl-3,4-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | 5-ethenyl-3,4-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 75041717 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 5-ethenyl-3,4-dimethyl-1,3-oxazolidin-2-one |
| SMILES | C=CC1OC(=O)N(C)C1C |
| InChI | InChI=1S/C7H11NO2/c1-4-6-5(2)8(3)7(9)10-6/h4-6H,1H2,2-3H3 |
| InChIKey | IOMMAZJKYDTWBF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|