C30H46Br2N10 — CID 75041885
3-[amino-(4-bromoanilino)methylidene]-2-[6-[[[[amino-(4-bromoanilino)methylidene]amino]-(diethylamino)methylidene]amino]hexyl]-1,1-diethylguanidine (PubChem CID 75041885) has the molecular formula C30H46Br2N10 and a molecular weight of 706.58 g/mol. Its IUPAC name is 3-[amino-(4-bromoanilino)methylidene]-2-[6-[[[[amino-(4-bromoanilino)methylidene]amino]-(diethylamino)methylidene]amino]hexyl]-1,1-diethylguanidine.
| Compound Name | 3-[amino-(4-bromoanilino)methylidene]-2-[6-[[[[amino-(4-bromoanilino)methylidene]amino]-(diethylamino)methylidene]amino]hexyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 75041885 |
| Molecular Formula | C30H46Br2N10 |
| Molecular Weight | 706.58 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | 3-[amino-(4-bromoanilino)methylidene]-2-[6-[[[[amino-(4-bromoanilino)methylidene]amino]-(diethylamino)methylidene]amino]hexyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N=C(N)Nc1ccc(Br)cc1)=N\CCCCCC/N=C(/N=C(N)Nc1ccc(Br)cc1)N(CC)CC |
| InChI | InChI=1S/C30H46Br2N10/c1-5-41(6-2)29(39-27(33)37-25-17-13-23(31)14-18-25)35-21-11-9-10-12-22-36-30(42(7-3)8-4)40-28(34)38-26-19-15-24(32)16-20-26/h13-20H,5-12,21-22H2,1-4H3,(H3,33,35,37,39)(H3,34,36,38,40) |
| InChIKey | WLPSNGYODAXUJZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|