About 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 750440) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| PubChem CID | 750440 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCc1c(C)nc2sc(C(N)=O)c(N)c2c1C |
| InChI | InChI=1S/C12H15N3OS/c1-4-7-5(2)8-9(13)10(11(14)16)17-12(8)15-6(7)3/h4,13H2,1-3H3,(H2,14,16) |
| InChIKey | CWKMPZOEUOYQAU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The IUPAC name of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CID 750440) is 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
What is the SMILES notation for 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The canonical SMILES for 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide is CCc1c(C)nc2sc(C(N)=O)c(N)c2c1C.
What is the InChIKey of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The InChIKey is CWKMPZOEUOYQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS/c1-4-7-5(2)8-9(13)10(11(14)16)17-12(8)15-6(7)3/h4,13H2,1-3H3,(H2,14,16).
What are the key properties of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide has a molecular weight of 249.34 g/mol, XLogP of 2.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide is sourced from PubChem (CID 750440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).