C23H34O5 — CID 75045987
5-[11-(furan-3-yl)-1-hydroxy-6-methoxy-4,8-dimethylundeca-4,8-dienyl]-5-methyloxolan-2-one (PubChem CID 75045987) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 5-[11-(furan-3-yl)-1-hydroxy-6-methoxy-4,8-dimethylundeca-4,8-dienyl]-5-methyloxolan-2-one.
| Compound Name | 5-[11-(furan-3-yl)-1-hydroxy-6-methoxy-4,8-dimethylundeca-4,8-dienyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 75045987 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 5-[11-(furan-3-yl)-1-hydroxy-6-methoxy-4,8-dimethylundeca-4,8-dienyl]-5-methyloxolan-2-one |
| SMILES | COC(C=C(C)CCC(O)C1(C)CCC(=O)O1)CC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C23H34O5/c1-17(6-5-7-19-11-13-27-16-19)14-20(26-4)15-18(2)8-9-21(24)23(3)12-10-22(25)28-23/h6,11,13,15-16,20-21,24H,5,7-10,12,14H2,1-4H3 |
| InChIKey | FADWJOIQAFPMNE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|