About 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene
8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene (PubChem CID 75046139) has the molecular formula C18H19F3O
and a molecular weight of 308.34 g/mol. Its IUPAC name is 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene.
Molecular Properties
| Compound Name | 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene |
| PubChem CID | 75046139 |
| Molecular Formula | C18H19F3O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene |
| SMILES | COC1(C)CC2(C)C=CC1C=C2c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H19F3O/c1-16-9-8-12(17(2,11-16)22-3)10-15(16)13-6-4-5-7-14(13)18(19,20)21/h4-10,12H,11H2,1-3H3 |
| InChIKey | YQONEBBYYNOCPG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene?
The IUPAC name of 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene (CID 75046139) is 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene.
What is the SMILES notation for 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene?
The canonical SMILES for 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene is COC1(C)CC2(C)C=CC1C=C2c1ccccc1C(F)(F)F.
What is the InChIKey of 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene?
The InChIKey is YQONEBBYYNOCPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3O/c1-16-9-8-12(17(2,11-16)22-3)10-15(16)13-6-4-5-7-14(13)18(19,20)21/h4-10,12H,11H2,1-3H3.
What are the key properties of 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene?
8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene has a molecular weight of 308.34 g/mol, XLogP of 5.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-1,8-dimethyl-2-[2-(trifluoromethyl)phenyl]bicyclo[2.2.2]octa-2,5-diene is sourced from PubChem (CID 75046139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).