C26H35NO6 — CID 75046761
4-[5-(6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl)-4-oxohex-2-enyl]piperidine-2,6-dione (PubChem CID 75046761) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[5-(6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl)-4-oxohex-2-enyl]piperidine-2,6-dione.
| Compound Name | 4-[5-(6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl)-4-oxohex-2-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 75046761 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-[5-(6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl)-4-oxohex-2-enyl]piperidine-2,6-dione |
| SMILES | CC1=CC(C)C(O)CC=CCCC=CC(=O)OC1C(C)C(=O)C=CCC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C26H35NO6/c1-17-14-18(2)26(33-25(32)13-8-6-4-5-7-11-21(17)28)19(3)22(29)12-9-10-20-15-23(30)27-24(31)16-20/h5,7-9,12-14,17,19-21,26,28H,4,6,10-11,15-16H2,1-3H3,(H,27,30,31) |
| InChIKey | WHBZZYNJIVYKBG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|