C7H11N3S3 — CID 75046918
N,N-diethyl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide (PubChem CID 75046918) has the molecular formula C7H11N3S3 and a molecular weight of 233.39 g/mol. Its IUPAC name is N,N-diethyl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide.
| Compound Name | N,N-diethyl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide |
|---|---|
| PubChem CID | 75046918 |
| Molecular Formula | C7H11N3S3 |
| Molecular Weight | 233.39 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | N,N-diethyl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide |
| SMILES | CCN(C=Nc1nc(=S)ss1)CC |
| InChI | InChI=1S/C7H11N3S3/c1-3-10(4-2)5-8-6-9-7(11)13-12-6/h5H,3-4H2,1-2H3 |
| InChIKey | BBWROBXLTFDUFQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|