C32H37FO6S3 — CID 75047735
2-[2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 75047735) has the molecular formula C32H37FO6S3 and a molecular weight of 632.84 g/mol. Its IUPAC name is 2-[2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate.
| Compound Name | 2-[2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 75047735 |
| Molecular Formula | C32H37FO6S3 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | 2-[2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | CC1=C(CC(=O)OCCOCCOC(=O)CCCCC2CCSS2)c2cc(F)ccc2C1=Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C32H37FO6S3/c1-22-28(19-23-7-10-26(11-8-23)42(2)36)27-12-9-24(33)20-30(27)29(22)21-32(35)39-17-15-37-14-16-38-31(34)6-4-3-5-25-13-18-40-41-25/h7-12,19-20,25H,3-6,13-18,21H2,1-2H3 |
| InChIKey | ZBZBZTUNMOAURF-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|