C38H52O6 — CID 75049589
10-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6a,6b,9,9,12a-hexamethyl-3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid (PubChem CID 75049589) has the molecular formula C38H52O6 and a molecular weight of 604.83 g/mol. Its IUPAC name is 10-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6a,6b,9,9,12a-hexamethyl-3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid.
| Compound Name | 10-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6a,6b,9,9,12a-hexamethyl-3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 75049589 |
| Molecular Formula | C38H52O6 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 10-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6a,6b,9,9,12a-hexamethyl-3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC2CCC3(C)C(=CCC4C5(C)CCC(OC(=O)C=Cc6ccc(O)c(O)c6)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C38H52O6/c1-34(2)29-15-20-38(6)30(11-9-26-25-22-35(3,33(42)43)17-13-24(25)14-19-37(26,38)5)36(29,4)18-16-31(34)44-32(41)12-8-23-7-10-27(39)28(40)21-23/h7-10,12,21,24-25,29-31,39-40H,11,13-20,22H2,1-6H3,(H,42,43) |
| InChIKey | YXGXPJKLXCGTGN-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|