C18H17BrN4O2 — CID 75060573
N-[(4-bromo-1-methylpyrazol-3-yl)methylideneamino]-2-methoxy-2-naphthalen-2-ylacetamide (PubChem CID 75060573) has the molecular formula C18H17BrN4O2 and a molecular weight of 401.26 g/mol. Its IUPAC name is N-[(4-bromo-1-methylpyrazol-3-yl)methylideneamino]-2-methoxy-2-naphthalen-2-ylacetamide.
| Compound Name | N-[(4-bromo-1-methylpyrazol-3-yl)methylideneamino]-2-methoxy-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 75060573 |
| Molecular Formula | C18H17BrN4O2 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | N-[(4-bromo-1-methylpyrazol-3-yl)methylideneamino]-2-methoxy-2-naphthalen-2-ylacetamide |
| SMILES | COC(C(=O)NN=Cc1nn(C)cc1Br)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H17BrN4O2/c1-23-11-15(19)16(22-23)10-20-21-18(24)17(25-2)14-8-7-12-5-3-4-6-13(12)9-14/h3-11,17H,1-2H3,(H,21,24) |
| InChIKey | WHAAWTRPBFYKTC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|