C18H15ClN2O3 — CID 7506487
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 3-chlorobenzoate (PubChem CID 7506487) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 3-chlorobenzoate.
| Compound Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 7506487 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 3-chlorobenzoate |
| SMILES | O=C(OCC(=O)N1CCC(c2ccccc2)=N1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClN2O3/c19-15-8-4-7-14(11-15)18(23)24-12-17(22)21-10-9-16(20-21)13-5-2-1-3-6-13/h1-8,11H,9-10,12H2 |
| InChIKey | VQJVKVSAMNOURR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |