C20H20N2O4S — CID 7506895
(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2-(2,3-dimethylphenoxy)acetate (PubChem CID 7506895) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2-(2,3-dimethylphenoxy)acetate.
| Compound Name | (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2-(2,3-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 7506895 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 2-(2,3-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)OCc2nc3sc4c(c3c(=O)[nH]2)CCC4)c1C |
| InChI | InChI=1S/C20H20N2O4S/c1-11-5-3-7-14(12(11)2)25-10-17(23)26-9-16-21-19(24)18-13-6-4-8-15(13)27-20(18)22-16/h3,5,7H,4,6,8-10H2,1-2H3,(H,21,22,24) |
| InChIKey | YPZZWPJOURJWFX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |