C10H21NO5 — CID 75069816
1-butyl-6-(hydroxymethyl)piperidine-2,3,4,5-tetrol (PubChem CID 75069816) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-butyl-6-(hydroxymethyl)piperidine-2,3,4,5-tetrol.
| Compound Name | 1-butyl-6-(hydroxymethyl)piperidine-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 75069816 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-butyl-6-(hydroxymethyl)piperidine-2,3,4,5-tetrol |
| SMILES | CCCCN1C(O)C(O)C(O)C(O)C1CO |
| InChI | InChI=1S/C10H21NO5/c1-2-3-4-11-6(5-12)7(13)8(14)9(15)10(11)16/h6-10,12-16H,2-5H2,1H3 |
| InChIKey | JNYIOZRCMYRRED-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |