C7H9N3O4 — CID 75071587
6-methoxy-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 75071587) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 6-methoxy-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | 6-methoxy-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 75071587 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 6-methoxy-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | COC1COc2nc([N+](=O)[O-])cn2C1 |
| InChI | InChI=1S/C7H9N3O4/c1-13-5-2-9-3-6(10(11)12)8-7(9)14-4-5/h3,5H,2,4H2,1H3 |
| InChIKey | NBXCRLFFWUVSPA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|