C19H21ClN6 — CID 75076659
3-(2-chloro-4-pyridinyl)-2-cyclopropyl-6-(3-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine (PubChem CID 75076659) has the molecular formula C19H21ClN6 and a molecular weight of 368.87 g/mol. Its IUPAC name is 3-(2-chloro-4-pyridinyl)-2-cyclopropyl-6-(3-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine.
| Compound Name | 3-(2-chloro-4-pyridinyl)-2-cyclopropyl-6-(3-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 75076659 |
| Molecular Formula | C19H21ClN6 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-(2-chloro-4-pyridinyl)-2-cyclopropyl-6-(3-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine |
| SMILES | CC1CN(c2ccc3nc(C4CC4)c(-c4ccnc(Cl)c4)n3n2)CCN1 |
| InChI | InChI=1S/C19H21ClN6/c1-12-11-25(9-8-21-12)17-5-4-16-23-18(13-2-3-13)19(26(16)24-17)14-6-7-22-15(20)10-14/h4-7,10,12-13,21H,2-3,8-9,11H2,1H3 |
| InChIKey | PVNOMSMGWDMHHR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|