About spiro[1H-indole-3,4'-oxolane]-2,2'-dione
spiro[1H-indole-3,4'-oxolane]-2,2'-dione (PubChem CID 75077203) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is spiro[1H-indole-3,4'-oxolane]-2,2'-dione.
Molecular Properties
| Compound Name | spiro[1H-indole-3,4'-oxolane]-2,2'-dione |
| PubChem CID | 75077203 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | spiro[1H-indole-3,4'-oxolane]-2,2'-dione |
| SMILES | O=C1CC2(CO1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C11H9NO3/c13-9-5-11(6-15-9)7-3-1-2-4-8(7)12-10(11)14/h1-4H,5-6H2,(H,12,14) |
| InChIKey | FUTFUHSQWAIQSA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1H-indole-3,4'-oxolane]-2,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-indole-3,4'-oxolane]-2,2'-dione?
The IUPAC name of spiro[1H-indole-3,4'-oxolane]-2,2'-dione (CID 75077203) is spiro[1H-indole-3,4'-oxolane]-2,2'-dione.
What is the SMILES notation for spiro[1H-indole-3,4'-oxolane]-2,2'-dione?
The canonical SMILES for spiro[1H-indole-3,4'-oxolane]-2,2'-dione is O=C1CC2(CO1)C(=O)Nc1ccccc12.
What is the InChIKey of spiro[1H-indole-3,4'-oxolane]-2,2'-dione?
The InChIKey is FUTFUHSQWAIQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c13-9-5-11(6-15-9)7-3-1-2-4-8(7)12-10(11)14/h1-4H,5-6H2,(H,12,14).
What are the key properties of spiro[1H-indole-3,4'-oxolane]-2,2'-dione?
spiro[1H-indole-3,4'-oxolane]-2,2'-dione has a molecular weight of 203.20 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-indole-3,4'-oxolane]-2,2'-dione is sourced from PubChem (CID 75077203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).