C19H20O4 — CID 75078955
4-(7-methoxy-3-methyl-5-prop-1-enyl-2,3-dihydro-1-benzofuran-2-yl)benzene-1,2-diol (PubChem CID 75078955) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-(7-methoxy-3-methyl-5-prop-1-enyl-2,3-dihydro-1-benzofuran-2-yl)benzene-1,2-diol.
| Compound Name | 4-(7-methoxy-3-methyl-5-prop-1-enyl-2,3-dihydro-1-benzofuran-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 75078955 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-(7-methoxy-3-methyl-5-prop-1-enyl-2,3-dihydro-1-benzofuran-2-yl)benzene-1,2-diol |
| SMILES | CC=Cc1cc(OC)c2c(c1)C(C)C(c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C19H20O4/c1-4-5-12-8-14-11(2)18(23-19(14)17(9-12)22-3)13-6-7-15(20)16(21)10-13/h4-11,18,20-21H,1-3H3 |
| InChIKey | UKKOBYISDCTTBC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|