C20H16N4O4 — CID 75080808
5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-5-methyl-3-phenylimidazolidine-2,4-dione (PubChem CID 75080808) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is 5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-5-methyl-3-phenylimidazolidine-2,4-dione.
| Compound Name | 5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-5-methyl-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75080808 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-5-methyl-3-phenylimidazolidine-2,4-dione |
| SMILES | CC1(C=C2NC(=O)N(c3ccccc3)C2=O)NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H16N4O4/c1-20(17(26)24(19(28)22-20)14-10-6-3-7-11-14)12-15-16(25)23(18(27)21-15)13-8-4-2-5-9-13/h2-12H,1H3,(H,21,27)(H,22,28) |
| InChIKey | RGOABDVPYSFSDI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|