C18H18ClF3N2O3S — CID 75081093
5-[[3-chloro-2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 75081093) has the molecular formula C18H18ClF3N2O3S and a molecular weight of 434.87 g/mol. Its IUPAC name is 5-[[3-chloro-2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-chloro-2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75081093 |
| Molecular Formula | C18H18ClF3N2O3S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 5-[[3-chloro-2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cc(C(F)(F)F)cc(Cl)c2N2CCC(CCO)CC2)S1 |
| InChI | InChI=1S/C18H18ClF3N2O3S/c19-13-9-12(18(20,21)22)7-11(8-14-16(26)23-17(27)28-14)15(13)24-4-1-10(2-5-24)3-6-25/h7-10,25H,1-6H2,(H,23,26,27) |
| InChIKey | RZBQYBODURYYCR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|