C10H16Cl3N3O5 — CID 75084801
methanol;methyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)ethyl]carbamate (PubChem CID 75084801) has the molecular formula C10H16Cl3N3O5 and a molecular weight of 364.61 g/mol. Its IUPAC name is methanol;methyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)ethyl]carbamate.
| Compound Name | methanol;methyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 75084801 |
| Molecular Formula | C10H16Cl3N3O5 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | methanol;methyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)ethyl]carbamate |
| SMILES | CO.COC(=O)NC(N1CC(C)C(=O)NC1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3N3O4.CH4O/c1-4-3-15(7(17)13-5(4)16)6(9(10,11)12)14-8(18)19-2;1-2/h4,6H,3H2,1-2H3,(H,14,18)(H,13,16,17);2H,1H3 |
| InChIKey | YTDQQGILGSDBEE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|