C16H24N2O2 — CID 75088525
methyl 2-(2-butylpiperazin-1-yl)benzoate (PubChem CID 75088525) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl 2-(2-butylpiperazin-1-yl)benzoate.
| Compound Name | methyl 2-(2-butylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 75088525 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | methyl 2-(2-butylpiperazin-1-yl)benzoate |
| SMILES | CCCCC1CNCCN1c1ccccc1C(=O)OC |
| InChI | InChI=1S/C16H24N2O2/c1-3-4-7-13-12-17-10-11-18(13)15-9-6-5-8-14(15)16(19)20-2/h5-6,8-9,13,17H,3-4,7,10-12H2,1-2H3 |
| InChIKey | PHXNHANLYBUQKJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |