About 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (PubChem CID 75088955) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 75088955 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid |
| SMILES | CCCC1=NC(C(=O)O)CO1 |
| InChI | InChI=1S/C7H11NO3/c1-2-3-6-8-5(4-11-6)7(9)10/h5H,2-4H2,1H3,(H,9,10) |
| InChIKey | FEAQDXAQQWQSCO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (CID 75088955) is 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is CCCC1=NC(C(=O)O)CO1.
What is the InChIKey of 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The InChIKey is FEAQDXAQQWQSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-3-6-8-5(4-11-6)7(9)10/h5H,2-4H2,1H3,(H,9,10).
What are the key properties of 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 75088955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).