About 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde
5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde (PubChem CID 75089030) has the molecular formula C8H9NO2
and a molecular weight of 151.17 g/mol. Its IUPAC name is 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde |
| PubChem CID | 75089030 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde |
| SMILES | O=CC1CCN2C(=O)C=CC12 |
| InChI | InChI=1S/C8H9NO2/c10-5-6-3-4-9-7(6)1-2-8(9)11/h1-2,5-7H,3-4H2 |
| InChIKey | DALSGABBFDNDEN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde?
The IUPAC name of 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde (CID 75089030) is 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde.
What is the SMILES notation for 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde?
The canonical SMILES for 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde is O=CC1CCN2C(=O)C=CC12.
What is the InChIKey of 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde?
The InChIKey is DALSGABBFDNDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c10-5-6-3-4-9-7(6)1-2-8(9)11/h1-2,5-7H,3-4H2.
What are the key properties of 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde?
5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde has a molecular weight of 151.17 g/mol, XLogP of -0.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde is sourced from PubChem (CID 75089030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).