About 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid
4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 75089468) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 75089468 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC(C)C1C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3,5-8H,4H2,1-2H3,(H,11,12) |
| InChIKey | GOIHTQZDAFNYKF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid (CID 75089468) is 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid is CC(C)C1C=CC(C(=O)O)=CC1.
What is the InChIKey of 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is GOIHTQZDAFNYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3,5-8H,4H2,1-2H3,(H,11,12).
What are the key properties of 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid?
4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 166.22 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylcyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 75089468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).