C18H21NO4 — CID 7509344
propan-2-yl (E)-2-cyano-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate (PubChem CID 7509344) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is propan-2-yl (E)-2-cyano-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate.
| Compound Name | propan-2-yl (E)-2-cyano-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7509344 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | propan-2-yl (E)-2-cyano-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate |
| SMILES | CCOc1cc2c(cc1/C=C(\C#N)C(=O)OC(C)C)O[C@H](C)C2 |
| InChI | InChI=1S/C18H21NO4/c1-5-21-16-8-13-6-12(4)23-17(13)9-14(16)7-15(10-19)18(20)22-11(2)3/h7-9,11-12H,5-6H2,1-4H3/b15-7+/t12-/m1/s1 |
| InChIKey | GKDJSSMDSGXDLV-IWTIEGKHSA-N |
| XLogP | 3.27 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|