C23H23N3O7S — CID 75095204
acetic acid;2-(3,4-dimethoxyphenyl)-5-[(2,4-dimethoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 75095204) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is acetic acid;2-(3,4-dimethoxyphenyl)-5-[(2,4-dimethoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | acetic acid;2-(3,4-dimethoxyphenyl)-5-[(2,4-dimethoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 75095204 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | acetic acid;2-(3,4-dimethoxyphenyl)-5-[(2,4-dimethoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CC(=O)O.COc1ccc(C=c2sc3nc(-c4ccc(OC)c(OC)c4)nn3c2=O)c(OC)c1 |
| InChI | InChI=1S/C21H19N3O5S.C2H4O2/c1-26-14-7-5-12(16(11-14)28-3)10-18-20(25)24-21(30-18)22-19(23-24)13-6-8-15(27-2)17(9-13)29-4;1-2(3)4/h5-11H,1-4H3;1H3,(H,3,4) |
| InChIKey | YSUJJUGKMLYJGG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |