C14H22N2O5 — CID 75095881
tert-butyl 6-cyano-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate (PubChem CID 75095881) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is tert-butyl 6-cyano-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 6-cyano-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 75095881 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | tert-butyl 6-cyano-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
| SMILES | COC1(OC)COC2C(C#N)CN(C(=O)OC(C)(C)C)C21 |
| InChI | InChI=1S/C14H22N2O5/c1-13(2,3)21-12(17)16-7-9(6-15)10-11(16)14(18-4,19-5)8-20-10/h9-11H,7-8H2,1-5H3 |
| InChIKey | QGFQKKLSTXKQPY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|