C30H37ClFN7O2 — CID 75096267
N-[2-[4-(4-chloropyrimidin-2-yl)-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide (PubChem CID 75096267) has the molecular formula C30H37ClFN7O2 and a molecular weight of 582.12 g/mol. Its IUPAC name is N-[2-[4-(4-chloropyrimidin-2-yl)-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide.
| Compound Name | N-[2-[4-(4-chloropyrimidin-2-yl)-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 75096267 |
| Molecular Formula | C30H37ClFN7O2 |
| Molecular Weight | 582.12 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | N-[2-[4-(4-chloropyrimidin-2-yl)-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2C1C(c1c[nH]c3cc(F)ccc13)CN2c1nccc(Cl)n1)C1CCCCC1 |
| InChI | InChI=1S/C30H37ClFN7O2/c1-17(33-2)28(40)37-26(18-6-4-3-5-7-18)29(41)38-13-11-24-27(38)22(16-39(24)30-34-12-10-25(31)36-30)21-15-35-23-14-19(32)8-9-20(21)23/h8-10,12,14-15,17-18,22,24,26-27,33,35H,3-7,11,13,16H2,1-2H3,(H,37,40) |
| InChIKey | KPUHMPYXULUJMR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |