About 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one
3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one (PubChem CID 75097194) has the molecular formula C7H6F3NO3
and a molecular weight of 209.12 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one |
| PubChem CID | 75097194 |
| Molecular Formula | C7H6F3NO3 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(C=CC(F)(F)F)N1CCOC1=O |
| InChI | InChI=1S/C7H6F3NO3/c8-7(9,10)2-1-5(12)11-3-4-14-6(11)13/h1-2H,3-4H2 |
| InChIKey | IHPXBMQXKVJKIR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one (CID 75097194) is 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one is O=C(C=CC(F)(F)F)N1CCOC1=O.
What is the InChIKey of 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one?
The InChIKey is IHPXBMQXKVJKIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO3/c8-7(9,10)2-1-5(12)11-3-4-14-6(11)13/h1-2H,3-4H2.
What are the key properties of 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one?
3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one has a molecular weight of 209.12 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4,4-trifluorobut-2-enoyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 75097194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).