C10H11ClN2O3S — CID 7509966
4-(2-chlorophenyl)sulfonylpiperazin-2-one (PubChem CID 7509966) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 4-(2-chlorophenyl)sulfonylpiperazin-2-one.
| Compound Name | 4-(2-chlorophenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 7509966 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-(2-chlorophenyl)sulfonylpiperazin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccccc2Cl)CCN1 |
| InChI | InChI=1S/C10H11ClN2O3S/c11-8-3-1-2-4-9(8)17(15,16)13-6-5-12-10(14)7-13/h1-4H,5-7H2,(H,12,14) |
| InChIKey | ISASOANNNGVPRQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |