C24H30N4O4 — CID 75099957
[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-[3-(3-methoxyphenyl)pyrazolidin-4-yl]methanone (PubChem CID 75099957) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is [3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-[3-(3-methoxyphenyl)pyrazolidin-4-yl]methanone.
| Compound Name | [3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-[3-(3-methoxyphenyl)pyrazolidin-4-yl]methanone |
|---|---|
| PubChem CID | 75099957 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-[3-(3-methoxyphenyl)pyrazolidin-4-yl]methanone |
| SMILES | COc1cccc(C2NNCC2C(=O)N2CCCC(Nc3ccc4c(c3)OCCO4)C2)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-30-19-6-2-4-16(12-19)23-20(14-25-27-23)24(29)28-9-3-5-18(15-28)26-17-7-8-21-22(13-17)32-11-10-31-21/h2,4,6-8,12-13,18,20,23,25-27H,3,5,9-11,14-15H2,1H3 |
| InChIKey | RPXAJLRDJYITPK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|