C17H22N4O2S2 — CID 75100610
N-[2-[4-methyl-5-(oxolan-2-ylmethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 75100610) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[2-[4-methyl-5-(oxolan-2-ylmethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[2-[4-methyl-5-(oxolan-2-ylmethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 75100610 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[2-[4-methyl-5-(oxolan-2-ylmethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cn1c(CCNC(=O)C=Cc2cccs2)nnc1SCC1CCCO1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-21-15(19-20-17(21)25-12-13-4-2-10-23-13)8-9-18-16(22)7-6-14-5-3-11-24-14/h3,5-7,11,13H,2,4,8-10,12H2,1H3,(H,18,22) |
| InChIKey | TUKGHLBLVOQDGL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|