C16H26ClNO2 — CID 75106370
3-amino-1-cyclohexyl-2-(4-methoxyphenyl)propan-1-ol;hydrochloride (PubChem CID 75106370) has the molecular formula C16H26ClNO2 and a molecular weight of 299.84 g/mol. Its IUPAC name is 3-amino-1-cyclohexyl-2-(4-methoxyphenyl)propan-1-ol;hydrochloride.
| Compound Name | 3-amino-1-cyclohexyl-2-(4-methoxyphenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 75106370 |
| Molecular Formula | C16H26ClNO2 |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-amino-1-cyclohexyl-2-(4-methoxyphenyl)propan-1-ol;hydrochloride |
| SMILES | COc1ccc(C(CN)C(O)C2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C16H25NO2.ClH/c1-19-14-9-7-12(8-10-14)15(11-17)16(18)13-5-3-2-4-6-13;/h7-10,13,15-16,18H,2-6,11,17H2,1H3;1H |
| InChIKey | BISDZXSPECCJOM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |