C14H18N2O2 — CID 75107957
6-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylic acid (PubChem CID 75107957) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylic acid.
| Compound Name | 6-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 75107957 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylic acid |
| SMILES | O=C(O)C1NNC2CC(c3ccccc3)CCC21 |
| InChI | InChI=1S/C14H18N2O2/c17-14(18)13-11-7-6-10(8-12(11)15-16-13)9-4-2-1-3-5-9/h1-5,10-13,15-16H,6-8H2,(H,17,18) |
| InChIKey | MGKABHJWVMLRTE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |