About N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide
N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide (PubChem CID 751094) has the molecular formula C17H17N3O3
and a molecular weight of 311.34 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide |
| PubChem CID | 751094 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2nc3ccccc3[nH]2)cc1OC |
| InChI | InChI=1S/C17H17N3O3/c1-22-14-8-7-11(9-15(14)23-2)17(21)18-10-16-19-12-5-3-4-6-13(12)20-16/h3-9H,10H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | JANQZRWEDYHYJC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide?
The IUPAC name of N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide (CID 751094) is N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide.
What is the SMILES notation for N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide?
The canonical SMILES for N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide is COc1ccc(C(=O)NCc2nc3ccccc3[nH]2)cc1OC.
What is the InChIKey of N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide?
The InChIKey is JANQZRWEDYHYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3/c1-22-14-8-7-11(9-15(14)23-2)17(21)18-10-16-19-12-5-3-4-6-13(12)20-16/h3-9H,10H2,1-2H3,(H,18,21)(H,19,20).
What are the key properties of N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide?
N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide has a molecular weight of 311.34 g/mol, XLogP of 2.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-benzimidazol-2-ylmethyl)-3,4-dimethoxybenzamide is sourced from PubChem (CID 751094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).