C12H21N3O7 — CID 75110650
(3-carboxy-2-hydroxypropyl)-trimethylazanium;2,6-dioxo-1,3-diazinane-4-carboxylate (PubChem CID 75110650) has the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. Its IUPAC name is (3-carboxy-2-hydroxypropyl)-trimethylazanium;2,6-dioxo-1,3-diazinane-4-carboxylate.
| Compound Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;2,6-dioxo-1,3-diazinane-4-carboxylate |
|---|---|
| PubChem CID | 75110650 |
| Molecular Formula | C12H21N3O7 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;2,6-dioxo-1,3-diazinane-4-carboxylate |
| SMILES | C[N+](C)(C)CC(O)CC(=O)O.O=C1CC(C(=O)[O-])NC(=O)N1 |
| InChI | InChI=1S/C7H15NO3.C5H6N2O4/c1-8(2,3)5-6(9)4-7(10)11;8-3-1-2(4(9)10)6-5(11)7-3/h6,9H,4-5H2,1-3H3;2H,1H2,(H,9,10)(H2,6,7,8,11) |
| InChIKey | ANQOUVGSKHTGLK-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|