C24H36O8 — CID 75110993
(1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate (PubChem CID 75110993) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is (1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate.
| Compound Name | (1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 75110993 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate |
| SMILES | CC(=O)OC(C)C(C)(O)C(=O)OC1CCC2(C)CC(=O)C(=C(C)C)CC2C1(C)OC(C)=O |
| InChI | InChI=1S/C24H36O8/c1-13(2)17-11-19-22(6,12-18(17)27)10-9-20(24(19,8)32-16(5)26)31-21(28)23(7,29)14(3)30-15(4)25/h14,19-20,29H,9-12H2,1-8H3 |
| InChIKey | LUNCZNVVYHFMOQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|