C21H20ClFN2O — CID 75112907
1-(3-chlorophenyl)-N-[[6-(3-fluorophenyl)-5-methoxy-2-pyridinyl]methyl]ethanamine (PubChem CID 75112907) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[[6-(3-fluorophenyl)-5-methoxy-2-pyridinyl]methyl]ethanamine.
| Compound Name | 1-(3-chlorophenyl)-N-[[6-(3-fluorophenyl)-5-methoxy-2-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 75112907 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[[6-(3-fluorophenyl)-5-methoxy-2-pyridinyl]methyl]ethanamine |
| SMILES | COc1ccc(CNC(C)c2cccc(Cl)c2)nc1-c1cccc(F)c1 |
| InChI | InChI=1S/C21H20ClFN2O/c1-14(15-5-3-7-17(22)11-15)24-13-19-9-10-20(26-2)21(25-19)16-6-4-8-18(23)12-16/h3-12,14,24H,13H2,1-2H3 |
| InChIKey | BVTLNLPITBOQOK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |