About 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione
5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione (PubChem CID 75117798) has the molecular formula C12H20BrN4O2+
and a molecular weight of 332.22 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione.
Molecular Properties
| Compound Name | 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione |
| PubChem CID | 75117798 |
| Molecular Formula | C12H20BrN4O2+ |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione |
| SMILES | CN1CCN(CC2=[N+](C)C(=O)N(C)C(=O)C2Br)CC1 |
| InChI | InChI=1S/C12H20BrN4O2/c1-14-4-6-17(7-5-14)8-9-10(13)11(18)16(3)12(19)15(9)2/h10H,4-8H2,1-3H3/q+1 |
| InChIKey | DATRDCKWVAZGTA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 46.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione?
The IUPAC name of 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione (CID 75117798) is 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione.
What is the SMILES notation for 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione?
The canonical SMILES for 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione is CN1CCN(CC2=[N+](C)C(=O)N(C)C(=O)C2Br)CC1.
What is the InChIKey of 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione?
The InChIKey is DATRDCKWVAZGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20BrN4O2/c1-14-4-6-17(7-5-14)8-9-10(13)11(18)16(3)12(19)15(9)2/h10H,4-8H2,1-3H3/q+1.
What are the key properties of 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione?
5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione has a molecular weight of 332.22 g/mol, XLogP of -0.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-dimethyl-6-[(4-methylpiperazin-1-yl)methyl]-5H-pyrimidin-1-ium-2,4-dione is sourced from PubChem (CID 75117798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).