About 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione
1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione (PubChem CID 75118019) has the molecular formula C9H12N4O2S
and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione.
Molecular Properties
| Compound Name | 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione |
| PubChem CID | 75118019 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione |
| SMILES | CCN1C(=O)C2C(=NC(=S)N2C)N(C)C1=O |
| InChI | InChI=1S/C9H12N4O2S/c1-4-13-7(14)5-6(12(3)9(13)15)10-8(16)11(5)2/h5H,4H2,1-3H3 |
| InChIKey | ONBSRKRIMDYSBW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione?
The IUPAC name of 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione (CID 75118019) is 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione.
What is the SMILES notation for 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione?
The canonical SMILES for 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione is CCN1C(=O)C2C(=NC(=S)N2C)N(C)C1=O.
What is the InChIKey of 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione?
The InChIKey is ONBSRKRIMDYSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2S/c1-4-13-7(14)5-6(12(3)9(13)15)10-8(16)11(5)2/h5H,4H2,1-3H3.
What are the key properties of 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione?
1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione has a molecular weight of 240.29 g/mol, XLogP of -0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,7-dimethyl-8-sulfanylidene-5H-purine-2,6-dione is sourced from PubChem (CID 75118019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).