C19H19FN4O2S — CID 75118184
2-(4-fluorophenyl)-7-[(3-methoxyphenyl)methylsulfanyl]-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one (PubChem CID 75118184) has the molecular formula C19H19FN4O2S and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-7-[(3-methoxyphenyl)methylsulfanyl]-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one.
| Compound Name | 2-(4-fluorophenyl)-7-[(3-methoxyphenyl)methylsulfanyl]-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 75118184 |
| Molecular Formula | C19H19FN4O2S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-(4-fluorophenyl)-7-[(3-methoxyphenyl)methylsulfanyl]-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
| SMILES | COc1cccc(CSC2=NNC(=O)C3CC(c4ccc(F)cc4)NN23)c1 |
| InChI | InChI=1S/C19H19FN4O2S/c1-26-15-4-2-3-12(9-15)11-27-19-22-21-18(25)17-10-16(23-24(17)19)13-5-7-14(20)8-6-13/h2-9,16-17,23H,10-11H2,1H3,(H,21,25) |
| InChIKey | KKJQPRVFZXTGAI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |